About hydroxymethyl 3-methylbenzoate
hydroxymethyl 3-methylbenzoate (PubChem CID 54320661) has the molecular formula C9H10O3
and a molecular weight of 166.18 g/mol. Its IUPAC name is hydroxymethyl 3-methylbenzoate.
Molecular Properties
| Compound Name | hydroxymethyl 3-methylbenzoate |
| PubChem CID | 54320661 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | hydroxymethyl 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)OCO)c1 |
| InChI | InChI=1S/C9H10O3/c1-7-3-2-4-8(5-7)9(11)12-6-10/h2-5,10H,6H2,1H3 |
| InChIKey | PQPSMPVXOBLSDL-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze hydroxymethyl 3-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxymethyl 3-methylbenzoate?
The IUPAC name of hydroxymethyl 3-methylbenzoate (CID 54320661) is hydroxymethyl 3-methylbenzoate.
What is the SMILES notation for hydroxymethyl 3-methylbenzoate?
The canonical SMILES for hydroxymethyl 3-methylbenzoate is Cc1cccc(C(=O)OCO)c1.
What is the InChIKey of hydroxymethyl 3-methylbenzoate?
The InChIKey is PQPSMPVXOBLSDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3/c1-7-3-2-4-8(5-7)9(11)12-6-10/h2-5,10H,6H2,1H3.
What are the key properties of hydroxymethyl 3-methylbenzoate?
hydroxymethyl 3-methylbenzoate has a molecular weight of 166.18 g/mol, XLogP of 1.10, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxymethyl 3-methylbenzoate is sourced from PubChem (CID 54320661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).