C21H25N3O5S — CID 55356323
[2-[4-[(3-methylphenyl)methyl]piperazin-1-yl]-2-oxoethyl] 4-sulfamoylbenzoate (PubChem CID 55356323) has the molecular formula C21H25N3O5S and a molecular weight of 431.51 g/mol. Its IUPAC name is [2-[4-[(3-methylphenyl)methyl]piperazin-1-yl]-2-oxoethyl] 4-sulfamoylbenzoate.
| Compound Name | [2-[4-[(3-methylphenyl)methyl]piperazin-1-yl]-2-oxoethyl] 4-sulfamoylbenzoate |
|---|---|
| PubChem CID | 55356323 |
| Molecular Formula | C21H25N3O5S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | [2-[4-[(3-methylphenyl)methyl]piperazin-1-yl]-2-oxoethyl] 4-sulfamoylbenzoate |
| SMILES | Cc1cccc(CN2CCN(C(=O)COC(=O)c3ccc(S(N)(=O)=O)cc3)CC2)c1 |
| InChI | InChI=1S/C21H25N3O5S/c1-16-3-2-4-17(13-16)14-23-9-11-24(12-10-23)20(25)15-29-21(26)18-5-7-19(8-6-18)30(22,27)28/h2-8,13H,9-12,14-15H2,1H3,(H2,22,27,28) |
| InChIKey | OWLBBRFXBMMHJP-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |