C20H24N4O6S — CID 55528813
4-[2-[4-[(3-methylphenyl)methyl]piperazin-1-yl]-2-oxoethoxy]-3-nitrobenzenesulfonamide (PubChem CID 55528813) has the molecular formula C20H24N4O6S and a molecular weight of 448.50 g/mol. Its IUPAC name is 4-[2-[4-[(3-methylphenyl)methyl]piperazin-1-yl]-2-oxoethoxy]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[2-[4-[(3-methylphenyl)methyl]piperazin-1-yl]-2-oxoethoxy]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 55528813 |
| Molecular Formula | C20H24N4O6S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 4-[2-[4-[(3-methylphenyl)methyl]piperazin-1-yl]-2-oxoethoxy]-3-nitrobenzenesulfonamide |
| SMILES | Cc1cccc(CN2CCN(C(=O)COc3ccc(S(N)(=O)=O)cc3[N+](=O)[O-])CC2)c1 |
| InChI | InChI=1S/C20H24N4O6S/c1-15-3-2-4-16(11-15)13-22-7-9-23(10-8-22)20(25)14-30-19-6-5-17(31(21,28)29)12-18(19)24(26)27/h2-6,11-12H,7-10,13-14H2,1H3,(H2,21,28,29) |
| InChIKey | DEOZSDAKBMYACA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 136.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|