C17H20N4O6S2 — CID 55528316
3-nitro-4-[2-oxo-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]ethoxy]benzenesulfonamide (PubChem CID 55528316) has the molecular formula C17H20N4O6S2 and a molecular weight of 440.50 g/mol. Its IUPAC name is 3-nitro-4-[2-oxo-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]ethoxy]benzenesulfonamide.
| Compound Name | 3-nitro-4-[2-oxo-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]ethoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 55528316 |
| Molecular Formula | C17H20N4O6S2 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 3-nitro-4-[2-oxo-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]ethoxy]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(OCC(=O)N2CCN(Cc3cccs3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H20N4O6S2/c18-29(25,26)14-3-4-16(15(10-14)21(23)24)27-12-17(22)20-7-5-19(6-8-20)11-13-2-1-9-28-13/h1-4,9-10H,5-8,11-12H2,(H2,18,25,26) |
| InChIKey | OFYNADCPWVIPSS-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 136.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|