C23H28N2O4S — CID 55374658
[2-[4-[(3-methylphenyl)methyl]piperazin-1-yl]-2-oxoethyl] 2-ethylsulfinylbenzoate (PubChem CID 55374658) has the molecular formula C23H28N2O4S and a molecular weight of 428.55 g/mol. Its IUPAC name is [2-[4-[(3-methylphenyl)methyl]piperazin-1-yl]-2-oxoethyl] 2-ethylsulfinylbenzoate.
| Compound Name | [2-[4-[(3-methylphenyl)methyl]piperazin-1-yl]-2-oxoethyl] 2-ethylsulfinylbenzoate |
|---|---|
| PubChem CID | 55374658 |
| Molecular Formula | C23H28N2O4S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | [2-[4-[(3-methylphenyl)methyl]piperazin-1-yl]-2-oxoethyl] 2-ethylsulfinylbenzoate |
| SMILES | CCS(=O)c1ccccc1C(=O)OCC(=O)N1CCN(Cc2cccc(C)c2)CC1 |
| InChI | InChI=1S/C23H28N2O4S/c1-3-30(28)21-10-5-4-9-20(21)23(27)29-17-22(26)25-13-11-24(12-14-25)16-19-8-6-7-18(2)15-19/h4-10,15H,3,11-14,16-17H2,1-2H3 |
| InChIKey | JRBUXSOIVWSAGY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |