C21H23FN2O4S — CID 11924450
[2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 2-[(R)-ethylsulfinyl]benzoate (PubChem CID 11924450) has the molecular formula C21H23FN2O4S and a molecular weight of 418.49 g/mol. Its IUPAC name is [2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 2-[(R)-ethylsulfinyl]benzoate.
| Compound Name | [2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 2-[(R)-ethylsulfinyl]benzoate |
|---|---|
| PubChem CID | 11924450 |
| Molecular Formula | C21H23FN2O4S |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | [2-[4-(2-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 2-[(R)-ethylsulfinyl]benzoate |
| SMILES | CC[S@@](=O)c1ccccc1C(=O)OCC(=O)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C21H23FN2O4S/c1-2-29(27)19-10-6-3-7-16(19)21(26)28-15-20(25)24-13-11-23(12-14-24)18-9-5-4-8-17(18)22/h3-10H,2,11-15H2,1H3/t29-/m1/s1 |
| InChIKey | YEOUMZODUFCIKH-GDLZYMKVSA-N |
| XLogP | 2.46 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |