C20H21ClN2O3S — CID 8841052
[2-[4-(2-chlorophenyl)piperazin-1-yl]-2-oxoethyl] 2-methylsulfanylbenzoate (PubChem CID 8841052) has the molecular formula C20H21ClN2O3S and a molecular weight of 404.92 g/mol. Its IUPAC name is [2-[4-(2-chlorophenyl)piperazin-1-yl]-2-oxoethyl] 2-methylsulfanylbenzoate.
| Compound Name | [2-[4-(2-chlorophenyl)piperazin-1-yl]-2-oxoethyl] 2-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 8841052 |
| Molecular Formula | C20H21ClN2O3S |
| Molecular Weight | 404.92 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | [2-[4-(2-chlorophenyl)piperazin-1-yl]-2-oxoethyl] 2-methylsulfanylbenzoate |
| SMILES | CSc1ccccc1C(=O)OCC(=O)N1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C20H21ClN2O3S/c1-27-18-9-5-2-6-15(18)20(25)26-14-19(24)23-12-10-22(11-13-23)17-8-4-3-7-16(17)21/h2-9H,10-14H2,1H3 |
| InChIKey | KODURUXMHAVEFI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.92 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |