C21H24ClN3O3 — CID 9228798
[2-[4-(2-chlorophenyl)piperazin-1-yl]-2-oxoethyl] 3-(dimethylamino)benzoate (PubChem CID 9228798) has the molecular formula C21H24ClN3O3 and a molecular weight of 401.89 g/mol. Its IUPAC name is [2-[4-(2-chlorophenyl)piperazin-1-yl]-2-oxoethyl] 3-(dimethylamino)benzoate.
| Compound Name | [2-[4-(2-chlorophenyl)piperazin-1-yl]-2-oxoethyl] 3-(dimethylamino)benzoate |
|---|---|
| PubChem CID | 9228798 |
| Molecular Formula | C21H24ClN3O3 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | [2-[4-(2-chlorophenyl)piperazin-1-yl]-2-oxoethyl] 3-(dimethylamino)benzoate |
| SMILES | CN(C)c1cccc(C(=O)OCC(=O)N2CCN(c3ccccc3Cl)CC2)c1 |
| InChI | InChI=1S/C21H24ClN3O3/c1-23(2)17-7-5-6-16(14-17)21(27)28-15-20(26)25-12-10-24(11-13-25)19-9-4-3-8-18(19)22/h3-9,14H,10-13,15H2,1-2H3 |
| InChIKey | PKERIQPOTLFAKE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |