C19H19FO5S — CID 68819930
[2-(4-fluorophenyl)-4-hydroxy-3-(4-methylsulfonylphenyl)but-2-enyl] acetate (PubChem CID 68819930) has the molecular formula C19H19FO5S and a molecular weight of 378.42 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-4-hydroxy-3-(4-methylsulfonylphenyl)but-2-enyl] acetate.
| Compound Name | [2-(4-fluorophenyl)-4-hydroxy-3-(4-methylsulfonylphenyl)but-2-enyl] acetate |
|---|---|
| PubChem CID | 68819930 |
| Molecular Formula | C19H19FO5S |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | [2-(4-fluorophenyl)-4-hydroxy-3-(4-methylsulfonylphenyl)but-2-enyl] acetate |
| SMILES | CC(=O)OCC(=C(CO)c1ccc(S(C)(=O)=O)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H19FO5S/c1-13(22)25-12-19(15-3-7-16(20)8-4-15)18(11-21)14-5-9-17(10-6-14)26(2,23)24/h3-10,21H,11-12H2,1-2H3 |
| InChIKey | HDURYNMDIDGIMT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|