C24H28FNO5S2 — CID 73462508
[3-(4-fluorophenyl)-4-[methyl-(2-methyl-2-sulfanylpropyl)amino]-2-(4-methylsulfonylphenyl)-4-oxobut-2-enyl] acetate (PubChem CID 73462508) has the molecular formula C24H28FNO5S2 and a molecular weight of 493.62 g/mol. Its IUPAC name is [3-(4-fluorophenyl)-4-[methyl-(2-methyl-2-sulfanylpropyl)amino]-2-(4-methylsulfonylphenyl)-4-oxobut-2-enyl] acetate.
| Compound Name | [3-(4-fluorophenyl)-4-[methyl-(2-methyl-2-sulfanylpropyl)amino]-2-(4-methylsulfonylphenyl)-4-oxobut-2-enyl] acetate |
|---|---|
| PubChem CID | 73462508 |
| Molecular Formula | C24H28FNO5S2 |
| Molecular Weight | 493.62 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | [3-(4-fluorophenyl)-4-[methyl-(2-methyl-2-sulfanylpropyl)amino]-2-(4-methylsulfonylphenyl)-4-oxobut-2-enyl] acetate |
| SMILES | CC(=O)OCC(=C(C(=O)N(C)CC(C)(C)S)c1ccc(F)cc1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C24H28FNO5S2/c1-16(27)31-14-21(17-8-12-20(13-9-17)33(5,29)30)22(18-6-10-19(25)11-7-18)23(28)26(4)15-24(2,3)32/h6-13,32H,14-15H2,1-5H3 |
| InChIKey | BCRKPTWOZCJPNG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 80.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.62 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|