C19H17ClO6S — CID 11675901
(Z)-4-acetyloxy-3-[4-(chloromethylsulfonyl)phenyl]-2-phenylbut-2-enoic acid (PubChem CID 11675901) has the molecular formula C19H17ClO6S and a molecular weight of 408.86 g/mol. Its IUPAC name is (Z)-4-acetyloxy-3-[4-(chloromethylsulfonyl)phenyl]-2-phenylbut-2-enoic acid.
| Compound Name | (Z)-4-acetyloxy-3-[4-(chloromethylsulfonyl)phenyl]-2-phenylbut-2-enoic acid |
|---|---|
| PubChem CID | 11675901 |
| Molecular Formula | C19H17ClO6S |
| Molecular Weight | 408.86 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | (Z)-4-acetyloxy-3-[4-(chloromethylsulfonyl)phenyl]-2-phenylbut-2-enoic acid |
| SMILES | CC(=O)OC/C(=C(\C(=O)O)c1ccccc1)c1ccc(S(=O)(=O)CCl)cc1 |
| InChI | InChI=1S/C19H17ClO6S/c1-13(21)26-11-17(18(19(22)23)15-5-3-2-4-6-15)14-7-9-16(10-8-14)27(24,25)12-20/h2-10H,11-12H2,1H3,(H,22,23)/b18-17+ |
| InChIKey | LZGXHEJTAJBYIQ-ISLYRVAYSA-N |
| XLogP | 3.22 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.86 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|