C24H29NO9S — CID 69411961
[4-hydroxy-2-(4-methylsulfonylphenyl)-3-phenylbut-2-enyl] 6-nitrooxyhexyl carbonate (PubChem CID 69411961) has the molecular formula C24H29NO9S and a molecular weight of 507.56 g/mol. Its IUPAC name is [4-hydroxy-2-(4-methylsulfonylphenyl)-3-phenylbut-2-enyl] 6-nitrooxyhexyl carbonate.
| Compound Name | [4-hydroxy-2-(4-methylsulfonylphenyl)-3-phenylbut-2-enyl] 6-nitrooxyhexyl carbonate |
|---|---|
| PubChem CID | 69411961 |
| Molecular Formula | C24H29NO9S |
| Molecular Weight | 507.56 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | [4-hydroxy-2-(4-methylsulfonylphenyl)-3-phenylbut-2-enyl] 6-nitrooxyhexyl carbonate |
| SMILES | CS(=O)(=O)c1ccc(C(COC(=O)OCCCCCCO[N+](=O)[O-])=C(CO)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H29NO9S/c1-35(30,31)21-13-11-20(12-14-21)23(22(17-26)19-9-5-4-6-10-19)18-33-24(27)32-15-7-2-3-8-16-34-25(28)29/h4-6,9-14,26H,2-3,7-8,15-18H2,1H3 |
| InChIKey | VHOUBIRVXNEULI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 142.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.56 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|