C18H20F2N2O — CID 137083359
N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-5-ethyl-2-hydroxybenzenecarboximidamide (PubChem CID 137083359) has the molecular formula C18H20F2N2O and a molecular weight of 318.37 g/mol. Its IUPAC name is N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-5-ethyl-2-hydroxybenzenecarboximidamide.
| Compound Name | N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-5-ethyl-2-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 137083359 |
| Molecular Formula | C18H20F2N2O |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-5-ethyl-2-hydroxybenzenecarboximidamide |
| SMILES | CCc1ccc(O)c(/C(N)=N/Cc2ccc(C(C)(F)F)cc2)c1 |
| InChI | InChI=1S/C18H20F2N2O/c1-3-12-6-9-16(23)15(10-12)17(21)22-11-13-4-7-14(8-5-13)18(2,19)20/h4-10,23H,3,11H2,1-2H3,(H2,21,22) |
| InChIKey | OBJAKWUDTACCSB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|