C19H27F2N3 — CID 162593953
(2Z,4Z)-2-amino-N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-6,7-dimethylocta-2,4-dienimidamide (PubChem CID 162593953) has the molecular formula C19H27F2N3 and a molecular weight of 335.44 g/mol. Its IUPAC name is (2Z,4Z)-2-amino-N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-6,7-dimethylocta-2,4-dienimidamide.
| Compound Name | (2Z,4Z)-2-amino-N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-6,7-dimethylocta-2,4-dienimidamide |
|---|---|
| PubChem CID | 162593953 |
| Molecular Formula | C19H27F2N3 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | (2Z,4Z)-2-amino-N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-6,7-dimethylocta-2,4-dienimidamide |
| SMILES | CC(C)C(C)/C=C\C=C(N)\C(N)=N\Cc1ccc(C(C)(F)F)cc1 |
| InChI | InChI=1S/C19H27F2N3/c1-13(2)14(3)6-5-7-17(22)18(23)24-12-15-8-10-16(11-9-15)19(4,20)21/h5-11,13-14H,12,22H2,1-4H3,(H2,23,24)/b6-5-,17-7- |
| InChIKey | ZMEGFIPNUDYBEH-QVDIOOHOSA-N |
| XLogP | 4.35 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|