C17H17F3N2 — CID 123999158
N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-3-fluoro-4-methylbenzenecarboximidamide (PubChem CID 123999158) has the molecular formula C17H17F3N2 and a molecular weight of 306.33 g/mol. Its IUPAC name is N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-3-fluoro-4-methylbenzenecarboximidamide.
| Compound Name | N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-3-fluoro-4-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 123999158 |
| Molecular Formula | C17H17F3N2 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | N'-[[4-(1,1-difluoroethyl)phenyl]methyl]-3-fluoro-4-methylbenzenecarboximidamide |
| SMILES | Cc1ccc(/C(N)=N/Cc2ccc(C(C)(F)F)cc2)cc1F |
| InChI | InChI=1S/C17H17F3N2/c1-11-3-6-13(9-15(11)18)16(21)22-10-12-4-7-14(8-5-12)17(2,19)20/h3-9H,10H2,1-2H3,(H2,21,22) |
| InChIKey | QGWUZMXINGLFLX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|