C11H15FN2O — CID 63182012
5-fluoro-N'-(2-methoxyethyl)-2-methylbenzenecarboximidamide (PubChem CID 63182012) has the molecular formula C11H15FN2O and a molecular weight of 210.25 g/mol. Its IUPAC name is 5-fluoro-N'-(2-methoxyethyl)-2-methylbenzenecarboximidamide.
| Compound Name | 5-fluoro-N'-(2-methoxyethyl)-2-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 63182012 |
| Molecular Formula | C11H15FN2O |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 5-fluoro-N'-(2-methoxyethyl)-2-methylbenzenecarboximidamide |
| SMILES | COCC/N=C(\N)c1cc(F)ccc1C |
| InChI | InChI=1S/C11H15FN2O/c1-8-3-4-9(12)7-10(8)11(13)14-5-6-15-2/h3-4,7H,5-6H2,1-2H3,(H2,13,14) |
| InChIKey | OTPNNEAJXXXOGD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|