C16H12ClF3N2O4S2 — CID 141470635
2-(6-chloro-3-ethylsulfonyl-2-pyridinyl)-5-(trifluoromethylsulfonyl)-1H-indole (PubChem CID 141470635) has the molecular formula C16H12ClF3N2O4S2 and a molecular weight of 452.86 g/mol. Its IUPAC name is 2-(6-chloro-3-ethylsulfonyl-2-pyridinyl)-5-(trifluoromethylsulfonyl)-1H-indole.
| Compound Name | 2-(6-chloro-3-ethylsulfonyl-2-pyridinyl)-5-(trifluoromethylsulfonyl)-1H-indole |
|---|---|
| PubChem CID | 141470635 |
| Molecular Formula | C16H12ClF3N2O4S2 |
| Molecular Weight | 452.86 g/mol |
| Exact Mass | 451.99 |
| IUPAC Name | 2-(6-chloro-3-ethylsulfonyl-2-pyridinyl)-5-(trifluoromethylsulfonyl)-1H-indole |
| SMILES | CCS(=O)(=O)c1ccc(Cl)nc1-c1cc2cc(S(=O)(=O)C(F)(F)F)ccc2[nH]1 |
| InChI | InChI=1S/C16H12ClF3N2O4S2/c1-2-27(23,24)13-5-6-14(17)22-15(13)12-8-9-7-10(3-4-11(9)21-12)28(25,26)16(18,19)20/h3-8,21H,2H2,1H3 |
| InChIKey | MMYSJLXIEDJWMX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 96.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.86 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|