C18H20F2N2O3S — CID 134166754
2-[5-(2,2-difluoropropoxy)-2-pyridinyl]-3-ethylsulfonyl-5-prop-2-enylpyridine (PubChem CID 134166754) has the molecular formula C18H20F2N2O3S and a molecular weight of 382.43 g/mol. Its IUPAC name is 2-[5-(2,2-difluoropropoxy)-2-pyridinyl]-3-ethylsulfonyl-5-prop-2-enylpyridine.
| Compound Name | 2-[5-(2,2-difluoropropoxy)-2-pyridinyl]-3-ethylsulfonyl-5-prop-2-enylpyridine |
|---|---|
| PubChem CID | 134166754 |
| Molecular Formula | C18H20F2N2O3S |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 2-[5-(2,2-difluoropropoxy)-2-pyridinyl]-3-ethylsulfonyl-5-prop-2-enylpyridine |
| SMILES | C=CCc1cnc(-c2ccc(OCC(C)(F)F)cn2)c(S(=O)(=O)CC)c1 |
| InChI | InChI=1S/C18H20F2N2O3S/c1-4-6-13-9-16(26(23,24)5-2)17(22-10-13)15-8-7-14(11-21-15)25-12-18(3,19)20/h4,7-11H,1,5-6,12H2,2-3H3 |
| InChIKey | FCSFKGFRBKYZNC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|