C16H18F4N3O4S+ — CID 146272189
5-ethylsulfonyl-1-methoxy-6-[5-(2,2,3,3-tetrafluoropropoxy)-2-pyridinyl]pyridin-1-ium-3-amine (PubChem CID 146272189) has the molecular formula C16H18F4N3O4S+ and a molecular weight of 424.40 g/mol. Its IUPAC name is 5-ethylsulfonyl-1-methoxy-6-[5-(2,2,3,3-tetrafluoropropoxy)-2-pyridinyl]pyridin-1-ium-3-amine.
| Compound Name | 5-ethylsulfonyl-1-methoxy-6-[5-(2,2,3,3-tetrafluoropropoxy)-2-pyridinyl]pyridin-1-ium-3-amine |
|---|---|
| PubChem CID | 146272189 |
| Molecular Formula | C16H18F4N3O4S+ |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 5-ethylsulfonyl-1-methoxy-6-[5-(2,2,3,3-tetrafluoropropoxy)-2-pyridinyl]pyridin-1-ium-3-amine |
| SMILES | CCS(=O)(=O)c1cc(N)c[n+](OC)c1-c1ccc(OCC(F)(F)C(F)F)cn1 |
| InChI | InChI=1S/C16H18F4N3O4S/c1-3-28(24,25)13-6-10(21)8-23(26-2)14(13)12-5-4-11(7-22-12)27-9-16(19,20)15(17)18/h4-8,15H,3,9,21H2,1-2H3/q+1 |
| InChIKey | IGXMXGJGPOPYGM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|