C19H23F4N3O3S2 — CID 146272190
diethyl-[5-ethylsulfanyl-1-oxido-6-[5-(2,2,3,3-tetrafluoropropoxy)-2-pyridinyl]pyridin-1-ium-3-yl]imino-oxo-λ6-sulfane (PubChem CID 146272190) has the molecular formula C19H23F4N3O3S2 and a molecular weight of 481.54 g/mol. Its IUPAC name is diethyl-[5-ethylsulfanyl-1-oxido-6-[5-(2,2,3,3-tetrafluoropropoxy)-2-pyridinyl]pyridin-1-ium-3-yl]imino-oxo-λ6-sulfane.
| Compound Name | diethyl-[5-ethylsulfanyl-1-oxido-6-[5-(2,2,3,3-tetrafluoropropoxy)-2-pyridinyl]pyridin-1-ium-3-yl]imino-oxo-λ6-sulfane |
|---|---|
| PubChem CID | 146272190 |
| Molecular Formula | C19H23F4N3O3S2 |
| Molecular Weight | 481.54 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | diethyl-[5-ethylsulfanyl-1-oxido-6-[5-(2,2,3,3-tetrafluoropropoxy)-2-pyridinyl]pyridin-1-ium-3-yl]imino-oxo-λ6-sulfane |
| SMILES | CCSc1cc(N=S(=O)(CC)CC)c[n+]([O-])c1-c1ccc(OCC(F)(F)C(F)F)cn1 |
| InChI | InChI=1S/C19H23F4N3O3S2/c1-4-30-16-9-13(25-31(28,5-2)6-3)11-26(27)17(16)15-8-7-14(10-24-15)29-12-19(22,23)18(20)21/h7-11,18H,4-6,12H2,1-3H3 |
| InChIKey | ZCYUHMFSGFAMLG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 78.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|