C12H16F4N2O — CID 112584809
N-methyl-1-[5-(2,2,3,3-tetrafluoropropoxy)-2-pyridinyl]propan-1-amine (PubChem CID 112584809) has the molecular formula C12H16F4N2O and a molecular weight of 280.26 g/mol. Its IUPAC name is N-methyl-1-[5-(2,2,3,3-tetrafluoropropoxy)-2-pyridinyl]propan-1-amine.
| Compound Name | N-methyl-1-[5-(2,2,3,3-tetrafluoropropoxy)-2-pyridinyl]propan-1-amine |
|---|---|
| PubChem CID | 112584809 |
| Molecular Formula | C12H16F4N2O |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | N-methyl-1-[5-(2,2,3,3-tetrafluoropropoxy)-2-pyridinyl]propan-1-amine |
| SMILES | CCC(NC)c1ccc(OCC(F)(F)C(F)F)cn1 |
| InChI | InChI=1S/C12H16F4N2O/c1-3-9(17-2)10-5-4-8(6-18-10)19-7-12(15,16)11(13)14/h4-6,9,11,17H,3,7H2,1-2H3 |
| InChIKey | WIVABYPWRKJPJF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|