C13H18F3NO — CID 91558909
2-(3-methylpentan-2-yl)-5-(2,2,2-trifluoroethoxy)pyridine (PubChem CID 91558909) has the molecular formula C13H18F3NO and a molecular weight of 261.29 g/mol. Its IUPAC name is 2-(3-methylpentan-2-yl)-5-(2,2,2-trifluoroethoxy)pyridine.
| Compound Name | 2-(3-methylpentan-2-yl)-5-(2,2,2-trifluoroethoxy)pyridine |
|---|---|
| PubChem CID | 91558909 |
| Molecular Formula | C13H18F3NO |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 2-(3-methylpentan-2-yl)-5-(2,2,2-trifluoroethoxy)pyridine |
| SMILES | CCC(C)C(C)c1ccc(OCC(F)(F)F)cn1 |
| InChI | InChI=1S/C13H18F3NO/c1-4-9(2)10(3)12-6-5-11(7-17-12)18-8-13(14,15)16/h5-7,9-10H,4,8H2,1-3H3 |
| InChIKey | FWOSJHASVHJRAU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |