C17H16F3N3O — CID 141281987
1-[(1R)-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]-2H-quinoxaline (PubChem CID 141281987) has the molecular formula C17H16F3N3O and a molecular weight of 335.33 g/mol. Its IUPAC name is 1-[(1R)-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]-2H-quinoxaline.
| Compound Name | 1-[(1R)-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]-2H-quinoxaline |
|---|---|
| PubChem CID | 141281987 |
| Molecular Formula | C17H16F3N3O |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 1-[(1R)-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethyl]-2H-quinoxaline |
| SMILES | C[C@H](c1ccc(OCC(F)(F)F)cn1)N1CC=Nc2ccccc21 |
| InChI | InChI=1S/C17H16F3N3O/c1-12(23-9-8-21-15-4-2-3-5-16(15)23)14-7-6-13(10-22-14)24-11-17(18,19)20/h2-8,10,12H,9,11H2,1H3/t12-/m1/s1 |
| InChIKey | DCAPHEUBTVFVPH-GFCCVEGCSA-N |
| XLogP | 4.31 |
| TPSA | 37.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |