C10H13F3N2O — CID 169237349
N-propan-2-yl-5-(2,2,2-trifluoroethoxy)pyridin-2-amine (PubChem CID 169237349) has the molecular formula C10H13F3N2O and a molecular weight of 234.22 g/mol. Its IUPAC name is N-propan-2-yl-5-(2,2,2-trifluoroethoxy)pyridin-2-amine.
| Compound Name | N-propan-2-yl-5-(2,2,2-trifluoroethoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 169237349 |
| Molecular Formula | C10H13F3N2O |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | N-propan-2-yl-5-(2,2,2-trifluoroethoxy)pyridin-2-amine |
| SMILES | CC(C)Nc1ccc(OCC(F)(F)F)cn1 |
| InChI | InChI=1S/C10H13F3N2O/c1-7(2)15-9-4-3-8(5-14-9)16-6-10(11,12)13/h3-5,7H,6H2,1-2H3,(H,14,15) |
| InChIKey | MFBXHVVCXUVISK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |