C11H17F3N2O — CID 169238058
ethane;N-propan-2-yl-5-(trifluoromethoxy)pyridin-2-amine (PubChem CID 169238058) has the molecular formula C11H17F3N2O and a molecular weight of 250.26 g/mol. Its IUPAC name is ethane;N-propan-2-yl-5-(trifluoromethoxy)pyridin-2-amine.
| Compound Name | ethane;N-propan-2-yl-5-(trifluoromethoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 169238058 |
| Molecular Formula | C11H17F3N2O |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | ethane;N-propan-2-yl-5-(trifluoromethoxy)pyridin-2-amine |
| SMILES | CC.CC(C)Nc1ccc(OC(F)(F)F)cn1 |
| InChI | InChI=1S/C9H11F3N2O.C2H6/c1-6(2)14-8-4-3-7(5-13-8)15-9(10,11)12;1-2/h3-6H,1-2H3,(H,13,14);1-2H3 |
| InChIKey | UGYHKJGDACJVMX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |