C11H15F3N2OS — CID 133492021
N-(2-methyl-2-methylsulfanylpropyl)-5-(trifluoromethoxy)pyridin-2-amine (PubChem CID 133492021) has the molecular formula C11H15F3N2OS and a molecular weight of 280.31 g/mol. Its IUPAC name is N-(2-methyl-2-methylsulfanylpropyl)-5-(trifluoromethoxy)pyridin-2-amine.
| Compound Name | N-(2-methyl-2-methylsulfanylpropyl)-5-(trifluoromethoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 133492021 |
| Molecular Formula | C11H15F3N2OS |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | N-(2-methyl-2-methylsulfanylpropyl)-5-(trifluoromethoxy)pyridin-2-amine |
| SMILES | CSC(C)(C)CNc1ccc(OC(F)(F)F)cn1 |
| InChI | InChI=1S/C11H15F3N2OS/c1-10(2,18-3)7-16-9-5-4-8(6-15-9)17-11(12,13)14/h4-6H,7H2,1-3H3,(H,15,16) |
| InChIKey | HFZAYXUTTQGEDL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |