C15H23F3N4O — CID 133489757
N-[2-(4-ethylpiperazin-1-yl)propyl]-5-(trifluoromethoxy)pyridin-2-amine (PubChem CID 133489757) has the molecular formula C15H23F3N4O and a molecular weight of 332.37 g/mol. Its IUPAC name is N-[2-(4-ethylpiperazin-1-yl)propyl]-5-(trifluoromethoxy)pyridin-2-amine.
| Compound Name | N-[2-(4-ethylpiperazin-1-yl)propyl]-5-(trifluoromethoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 133489757 |
| Molecular Formula | C15H23F3N4O |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | N-[2-(4-ethylpiperazin-1-yl)propyl]-5-(trifluoromethoxy)pyridin-2-amine |
| SMILES | CCN1CCN(C(C)CNc2ccc(OC(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C15H23F3N4O/c1-3-21-6-8-22(9-7-21)12(2)10-19-14-5-4-13(11-20-14)23-15(16,17)18/h4-5,11-12H,3,6-10H2,1-2H3,(H,19,20) |
| InChIKey | BDYGTTXPKFSYQP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |