C14H11F5N2O2 — CID 133489068
N-[[2-(difluoromethoxy)phenyl]methyl]-5-(trifluoromethoxy)pyridin-2-amine (PubChem CID 133489068) has the molecular formula C14H11F5N2O2 and a molecular weight of 334.24 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)phenyl]methyl]-5-(trifluoromethoxy)pyridin-2-amine.
| Compound Name | N-[[2-(difluoromethoxy)phenyl]methyl]-5-(trifluoromethoxy)pyridin-2-amine |
|---|---|
| PubChem CID | 133489068 |
| Molecular Formula | C14H11F5N2O2 |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | N-[[2-(difluoromethoxy)phenyl]methyl]-5-(trifluoromethoxy)pyridin-2-amine |
| SMILES | FC(F)Oc1ccccc1CNc1ccc(OC(F)(F)F)cn1 |
| InChI | InChI=1S/C14H11F5N2O2/c15-13(16)22-11-4-2-1-3-9(11)7-20-12-6-5-10(8-21-12)23-14(17,18)19/h1-6,8,13H,7H2,(H,20,21) |
| InChIKey | NBMDKXHZRQFEIN-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |