C13H12F2N4O2 — CID 133370007
6-[[2-(difluoromethoxy)phenyl]methylamino]pyrazine-2-carboxamide (PubChem CID 133370007) has the molecular formula C13H12F2N4O2 and a molecular weight of 294.26 g/mol. Its IUPAC name is 6-[[2-(difluoromethoxy)phenyl]methylamino]pyrazine-2-carboxamide.
| Compound Name | 6-[[2-(difluoromethoxy)phenyl]methylamino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 133370007 |
| Molecular Formula | C13H12F2N4O2 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 6-[[2-(difluoromethoxy)phenyl]methylamino]pyrazine-2-carboxamide |
| SMILES | NC(=O)c1cncc(NCc2ccccc2OC(F)F)n1 |
| InChI | InChI=1S/C13H12F2N4O2/c14-13(15)21-10-4-2-1-3-8(10)5-18-11-7-17-6-9(19-11)12(16)20/h1-4,6-7,13H,5H2,(H2,16,20)(H,18,19) |
| InChIKey | NJNFMBIBMREBLW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |