About 5-(difluoromethyl)-N-propan-2-ylpyridin-2-amine;ethane
5-(difluoromethyl)-N-propan-2-ylpyridin-2-amine;ethane (PubChem CID 169237953) has the molecular formula C11H18F2N2
and a molecular weight of 216.28 g/mol. Its IUPAC name is 5-(difluoromethyl)-N-propan-2-ylpyridin-2-amine;ethane.
Molecular Properties
| Compound Name | 5-(difluoromethyl)-N-propan-2-ylpyridin-2-amine;ethane |
| PubChem CID | 169237953 |
| Molecular Formula | C11H18F2N2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 5-(difluoromethyl)-N-propan-2-ylpyridin-2-amine;ethane |
| SMILES | CC.CC(C)Nc1ccc(C(F)F)cn1 |
| InChI | InChI=1S/C9H12F2N2.C2H6/c1-6(2)13-8-4-3-7(5-12-8)9(10)11;1-2/h3-6,9H,1-2H3,(H,12,13);1-2H3 |
| InChIKey | VZARZPHJWMSSDS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(difluoromethyl)-N-propan-2-ylpyridin-2-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(difluoromethyl)-N-propan-2-ylpyridin-2-amine;ethane?
The IUPAC name of 5-(difluoromethyl)-N-propan-2-ylpyridin-2-amine;ethane (CID 169237953) is 5-(difluoromethyl)-N-propan-2-ylpyridin-2-amine;ethane.
What is the SMILES notation for 5-(difluoromethyl)-N-propan-2-ylpyridin-2-amine;ethane?
The canonical SMILES for 5-(difluoromethyl)-N-propan-2-ylpyridin-2-amine;ethane is CC.CC(C)Nc1ccc(C(F)F)cn1.
What is the InChIKey of 5-(difluoromethyl)-N-propan-2-ylpyridin-2-amine;ethane?
The InChIKey is VZARZPHJWMSSDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F2N2.C2H6/c1-6(2)13-8-4-3-7(5-12-8)9(10)11;1-2/h3-6,9H,1-2H3,(H,12,13);1-2H3.
What are the key properties of 5-(difluoromethyl)-N-propan-2-ylpyridin-2-amine;ethane?
5-(difluoromethyl)-N-propan-2-ylpyridin-2-amine;ethane has a molecular weight of 216.28 g/mol, XLogP of 3.87, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(difluoromethyl)-N-propan-2-ylpyridin-2-amine;ethane is sourced from PubChem (CID 169237953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).