C10H12F2N2 — CID 130559278
5-(difluoromethyl)-N-(2-methylcyclopropyl)pyridin-2-amine (PubChem CID 130559278) has the molecular formula C10H12F2N2 and a molecular weight of 198.22 g/mol. Its IUPAC name is 5-(difluoromethyl)-N-(2-methylcyclopropyl)pyridin-2-amine.
| Compound Name | 5-(difluoromethyl)-N-(2-methylcyclopropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 130559278 |
| Molecular Formula | C10H12F2N2 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 5-(difluoromethyl)-N-(2-methylcyclopropyl)pyridin-2-amine |
| SMILES | CC1CC1Nc1ccc(C(F)F)cn1 |
| InChI | InChI=1S/C10H12F2N2/c1-6-4-8(6)14-9-3-2-7(5-13-9)10(11)12/h2-3,5-6,8,10H,4H2,1H3,(H,13,14) |
| InChIKey | JSBCVJFLUVRCEZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |