C20H38N2Sn — CID 66934080
N-propan-2-yl-5-tributylstannylpyridin-2-amine (PubChem CID 66934080) has the molecular formula C20H38N2Sn and a molecular weight of 425.25 g/mol. Its IUPAC name is N-propan-2-yl-5-tributylstannylpyridin-2-amine.
| Compound Name | N-propan-2-yl-5-tributylstannylpyridin-2-amine |
|---|---|
| PubChem CID | 66934080 |
| Molecular Formula | C20H38N2Sn |
| Molecular Weight | 425.25 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | N-propan-2-yl-5-tributylstannylpyridin-2-amine |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccc(NC(C)C)nc1 |
| InChI | InChI=1S/C8H11N2.3C4H9.Sn/c1-7(2)10-8-5-3-4-6-9-8;3*1-3-4-2;/h3,5-7H,1-2H3,(H,9,10);3*1,3-4H2,2H3; |
| InChIKey | DZKHYDAFSPRSDG-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.25 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |