C13H18F3NO — CID 43686735
N-(3-methylbutan-2-yl)-4-(2,2,2-trifluoroethoxy)aniline (PubChem CID 43686735) has the molecular formula C13H18F3NO and a molecular weight of 261.29 g/mol. Its IUPAC name is N-(3-methylbutan-2-yl)-4-(2,2,2-trifluoroethoxy)aniline.
| Compound Name | N-(3-methylbutan-2-yl)-4-(2,2,2-trifluoroethoxy)aniline |
|---|---|
| PubChem CID | 43686735 |
| Molecular Formula | C13H18F3NO |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | N-(3-methylbutan-2-yl)-4-(2,2,2-trifluoroethoxy)aniline |
| SMILES | CC(C)C(C)Nc1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H18F3NO/c1-9(2)10(3)17-11-4-6-12(7-5-11)18-8-13(14,15)16/h4-7,9-10,17H,8H2,1-3H3 |
| InChIKey | SBQNVXAFHNTMBD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|