C15H22F3NO — CID 63944718
N-heptan-3-yl-4-(2,2,2-trifluoroethoxy)aniline (PubChem CID 63944718) has the molecular formula C15H22F3NO and a molecular weight of 289.34 g/mol. Its IUPAC name is N-heptan-3-yl-4-(2,2,2-trifluoroethoxy)aniline.
| Compound Name | N-heptan-3-yl-4-(2,2,2-trifluoroethoxy)aniline |
|---|---|
| PubChem CID | 63944718 |
| Molecular Formula | C15H22F3NO |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | N-heptan-3-yl-4-(2,2,2-trifluoroethoxy)aniline |
| SMILES | CCCCC(CC)Nc1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H22F3NO/c1-3-5-6-12(4-2)19-13-7-9-14(10-8-13)20-11-15(16,17)18/h7-10,12,19H,3-6,11H2,1-2H3 |
| InChIKey | XFBAPEJDBUVUKR-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|