C14H18F3NO2 — CID 134026710
2-methyl-N-[4-(2,2,2-trifluoroethoxy)phenyl]pentanamide (PubChem CID 134026710) has the molecular formula C14H18F3NO2 and a molecular weight of 289.30 g/mol. Its IUPAC name is 2-methyl-N-[4-(2,2,2-trifluoroethoxy)phenyl]pentanamide.
| Compound Name | 2-methyl-N-[4-(2,2,2-trifluoroethoxy)phenyl]pentanamide |
|---|---|
| PubChem CID | 134026710 |
| Molecular Formula | C14H18F3NO2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-methyl-N-[4-(2,2,2-trifluoroethoxy)phenyl]pentanamide |
| SMILES | CCCC(C)C(=O)Nc1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H18F3NO2/c1-3-4-10(2)13(19)18-11-5-7-12(8-6-11)20-9-14(15,16)17/h5-8,10H,3-4,9H2,1-2H3,(H,18,19) |
| InChIKey | MZKKATBIEPQSCH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |