C19H21F3N2O3 — CID 60586866
1-(4-ethoxyphenyl)-3-[1-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]urea (PubChem CID 60586866) has the molecular formula C19H21F3N2O3 and a molecular weight of 382.38 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-3-[1-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]urea.
| Compound Name | 1-(4-ethoxyphenyl)-3-[1-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 60586866 |
| Molecular Formula | C19H21F3N2O3 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 1-(4-ethoxyphenyl)-3-[1-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]urea |
| SMILES | CCOc1ccc(NC(=O)NC(C)c2ccc(OCC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H21F3N2O3/c1-3-26-16-10-6-15(7-11-16)24-18(25)23-13(2)14-4-8-17(9-5-14)27-12-19(20,21)22/h4-11,13H,3,12H2,1-2H3,(H2,23,24,25) |
| InChIKey | XUJGNEJTQZZOMW-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |