C18H18BrF3N2O2 — CID 112808744
1-[1-(4-bromophenyl)ethyl]-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]urea (PubChem CID 112808744) has the molecular formula C18H18BrF3N2O2 and a molecular weight of 431.25 g/mol. Its IUPAC name is 1-[1-(4-bromophenyl)ethyl]-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]urea.
| Compound Name | 1-[1-(4-bromophenyl)ethyl]-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 112808744 |
| Molecular Formula | C18H18BrF3N2O2 |
| Molecular Weight | 431.25 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | 1-[1-(4-bromophenyl)ethyl]-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]urea |
| SMILES | CC(NC(=O)NCc1ccc(OCC(F)(F)F)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H18BrF3N2O2/c1-12(14-4-6-15(19)7-5-14)24-17(25)23-10-13-2-8-16(9-3-13)26-11-18(20,21)22/h2-9,12H,10-11H2,1H3,(H2,23,24,25) |
| InChIKey | VVZNZMYQMSAIPP-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.25 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |