C20H23F3N2O2 — CID 112816056
1-(1-phenylbutyl)-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]urea (PubChem CID 112816056) has the molecular formula C20H23F3N2O2 and a molecular weight of 380.41 g/mol. Its IUPAC name is 1-(1-phenylbutyl)-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]urea.
| Compound Name | 1-(1-phenylbutyl)-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 112816056 |
| Molecular Formula | C20H23F3N2O2 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 1-(1-phenylbutyl)-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]urea |
| SMILES | CCCC(NC(=O)NCc1ccc(OCC(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H23F3N2O2/c1-2-6-18(16-7-4-3-5-8-16)25-19(26)24-13-15-9-11-17(12-10-15)27-14-20(21,22)23/h3-5,7-12,18H,2,6,13-14H2,1H3,(H2,24,25,26) |
| InChIKey | PMVHPBPZJJIYIH-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |