C19H21F3N6O2 — CID 86876885
1-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)butyl]-3-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]urea (PubChem CID 86876885) has the molecular formula C19H21F3N6O2 and a molecular weight of 422.41 g/mol. Its IUPAC name is 1-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)butyl]-3-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]urea.
| Compound Name | 1-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)butyl]-3-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]urea |
|---|---|
| PubChem CID | 86876885 |
| Molecular Formula | C19H21F3N6O2 |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 1-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)butyl]-3-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]urea |
| SMILES | CCCC(NC(=O)NCc1ccc(OCC(F)(F)F)nc1)c1nnc2ccccn12 |
| InChI | InChI=1S/C19H21F3N6O2/c1-2-5-14(17-27-26-15-6-3-4-9-28(15)17)25-18(29)24-11-13-7-8-16(23-10-13)30-12-19(20,21)22/h3-4,6-10,14H,2,5,11-12H2,1H3,(H2,24,25,29) |
| InChIKey | WFRGZFVRZYIMFT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |