C19H29N5O3 — CID 60614861
tert-butyl N-[4-oxo-4-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)butylamino]butyl]carbamate (PubChem CID 60614861) has the molecular formula C19H29N5O3 and a molecular weight of 375.47 g/mol. Its IUPAC name is tert-butyl N-[4-oxo-4-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)butylamino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-oxo-4-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)butylamino]butyl]carbamate |
|---|---|
| PubChem CID | 60614861 |
| Molecular Formula | C19H29N5O3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | tert-butyl N-[4-oxo-4-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)butylamino]butyl]carbamate |
| SMILES | CCCC(NC(=O)CCCNC(=O)OC(C)(C)C)c1nnc2ccccn12 |
| InChI | InChI=1S/C19H29N5O3/c1-5-9-14(17-23-22-15-10-6-7-13-24(15)17)21-16(25)11-8-12-20-18(26)27-19(2,3)4/h6-7,10,13-14H,5,8-9,11-12H2,1-4H3,(H,20,26)(H,21,25) |
| InChIKey | GJDGACLJUFCROE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|