C13H19N5O — CID 95317728
1-ethyl-3-[(1R)-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)butyl]urea (PubChem CID 95317728) has the molecular formula C13H19N5O and a molecular weight of 261.33 g/mol. Its IUPAC name is 1-ethyl-3-[(1R)-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)butyl]urea.
| Compound Name | 1-ethyl-3-[(1R)-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)butyl]urea |
|---|---|
| PubChem CID | 95317728 |
| Molecular Formula | C13H19N5O |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | 1-ethyl-3-[(1R)-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)butyl]urea |
| SMILES | CCC[C@@H](NC(=O)NCC)c1nnc2ccccn12 |
| InChI | InChI=1S/C13H19N5O/c1-3-7-10(15-13(19)14-4-2)12-17-16-11-8-5-6-9-18(11)12/h5-6,8-10H,3-4,7H2,1-2H3,(H2,14,15,19)/t10-/m1/s1 |
| InChIKey | FGCUAHMFXBZOGZ-SNVBAGLBSA-N |
| XLogP | 1.89 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |