C12H17N3 — CID 138507184
3-hexan-3-yl-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 138507184) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is 3-hexan-3-yl-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-hexan-3-yl-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 138507184 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 3-hexan-3-yl-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | CCCC(CC)c1nnc2ccccn12 |
| InChI | InChI=1S/C12H17N3/c1-3-7-10(4-2)12-14-13-11-8-5-6-9-15(11)12/h5-6,8-10H,3-4,7H2,1-2H3 |
| InChIKey | BYEJRSGWOPJLNH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |