C10H14N4 — CID 51880743
(1R)-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)butan-1-amine (PubChem CID 51880743) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is (1R)-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)butan-1-amine.
| Compound Name | (1R)-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)butan-1-amine |
|---|---|
| PubChem CID | 51880743 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | (1R)-1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)butan-1-amine |
| SMILES | CCC[C@@H](N)c1nnc2ccccn12 |
| InChI | InChI=1S/C10H14N4/c1-2-5-8(11)10-13-12-9-6-3-4-7-14(9)10/h3-4,6-8H,2,5,11H2,1H3/t8-/m1/s1 |
| InChIKey | RBOYUUKZWTVYLX-MRVPVSSYSA-N |
| XLogP | 1.53 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |