2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pentanoic acid

C11H13N3O2S — CID 83038187

IUPAC2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pentanoic acid
SMILESCCCC(Sc1nnc2ccccn12)C(=O)O
InChIInChI=1S/C11H13N3O2S/c1-2-5-8(10(15)16)17-11-13-12-9-6-3-4-7-14(9)11/h3-4,6-8H,2,5H2,1H3,(H,15,16)
InChIKeyZKGOHLDKHOXNLX-UHFFFAOYSA-N
MW251.31 g/mol
LogP2.07
Rot. Bonds5

About 2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pentanoic acid

2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pentanoic acid (PubChem CID 83038187) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is 2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pentanoic acid.

Molecular Properties

Compound Name2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pentanoic acid
PubChem CID83038187
Molecular FormulaC11H13N3O2S
Molecular Weight251.31 g/mol
Exact Mass251.07
IUPAC Name2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pentanoic acid
SMILESCCCC(Sc1nnc2ccccn12)C(=O)O
InChIInChI=1S/C11H13N3O2S/c1-2-5-8(10(15)16)17-11-13-12-9-6-3-4-7-14(9)11/h3-4,6-8H,2,5H2,1H3,(H,15,16)
InChIKeyZKGOHLDKHOXNLX-UHFFFAOYSA-N
XLogP2.07
TPSA67.49 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.31
LogP ≤ 52.07
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pentanoic acid?
The IUPAC name of 2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pentanoic acid (CID 83038187) is 2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pentanoic acid.
What is the SMILES notation for 2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pentanoic acid?
The canonical SMILES for 2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pentanoic acid is CCCC(Sc1nnc2ccccn12)C(=O)O.
What is the InChIKey of 2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pentanoic acid?
The InChIKey is ZKGOHLDKHOXNLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O2S/c1-2-5-8(10(15)16)17-11-13-12-9-6-3-4-7-14(9)11/h3-4,6-8H,2,5H2,1H3,(H,15,16).
What are the key properties of 2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pentanoic acid?
2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pentanoic acid has a molecular weight of 251.31 g/mol, XLogP of 2.07, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pentanoic acid is sourced from PubChem (CID 83038187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).