C11H13N3O2S — CID 83038187
2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pentanoic acid (PubChem CID 83038187) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is 2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pentanoic acid.
| Compound Name | 2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pentanoic acid |
|---|---|
| PubChem CID | 83038187 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 2-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)pentanoic acid |
| SMILES | CCCC(Sc1nnc2ccccn12)C(=O)O |
| InChI | InChI=1S/C11H13N3O2S/c1-2-5-8(10(15)16)17-11-13-12-9-6-3-4-7-14(9)11/h3-4,6-8H,2,5H2,1H3,(H,15,16) |
| InChIKey | ZKGOHLDKHOXNLX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |