C10H11N3O2S — CID 62849275
3-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)butanoic acid (PubChem CID 62849275) has the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. Its IUPAC name is 3-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)butanoic acid.
| Compound Name | 3-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)butanoic acid |
|---|---|
| PubChem CID | 62849275 |
| Molecular Formula | C10H11N3O2S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 3-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)butanoic acid |
| SMILES | CC(CC(=O)O)Sc1nnc2ccccn12 |
| InChI | InChI=1S/C10H11N3O2S/c1-7(6-9(14)15)16-10-12-11-8-4-2-3-5-13(8)10/h2-5,7H,6H2,1H3,(H,14,15) |
| InChIKey | SNRRDMZESBMYHZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |