C10H13N5OS — CID 76950750
N'-hydroxy-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)butanimidamide (PubChem CID 76950750) has the molecular formula C10H13N5OS and a molecular weight of 251.32 g/mol. Its IUPAC name is N'-hydroxy-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)butanimidamide.
| Compound Name | N'-hydroxy-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)butanimidamide |
|---|---|
| PubChem CID | 76950750 |
| Molecular Formula | C10H13N5OS |
| Molecular Weight | 251.32 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | N'-hydroxy-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylsulfanyl)butanimidamide |
| SMILES | CC(CC(N)=NO)Sc1nnc2ccccn12 |
| InChI | InChI=1S/C10H13N5OS/c1-7(6-8(11)14-16)17-10-13-12-9-4-2-3-5-15(9)10/h2-5,7,16H,6H2,1H3,(H2,11,14) |
| InChIKey | QVVDQOJESOKTQD-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 88.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|