About 2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanol
2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanol (PubChem CID 24695884) has the molecular formula C8H10N4O
and a molecular weight of 178.20 g/mol. Its IUPAC name is 2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanol.
Analyze 2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanol?
The IUPAC name of 2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanol (CID 24695884) is 2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanol.
What is the SMILES notation for 2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanol?
The canonical SMILES for 2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanol is NC(CO)c1nnc2ccccn12.
What is the InChIKey of 2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanol?
The InChIKey is DFUYSGRZEOOQBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O/c9-6(5-13)8-11-10-7-3-1-2-4-12(7)8/h1-4,6,13H,5,9H2.
What are the key properties of 2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanol?
2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanol has a molecular weight of 178.20 g/mol, XLogP of -0.28, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanol is sourced from PubChem (CID 24695884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).