C17H25N5O3 — CID 60613145
tert-butyl N-[4-[methyl([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)amino]-4-oxobutyl]carbamate (PubChem CID 60613145) has the molecular formula C17H25N5O3 and a molecular weight of 347.42 g/mol. Its IUPAC name is tert-butyl N-[4-[methyl([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)amino]-4-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[4-[methyl([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)amino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 60613145 |
| Molecular Formula | C17H25N5O3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | tert-butyl N-[4-[methyl([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)amino]-4-oxobutyl]carbamate |
| SMILES | CN(Cc1nnc2ccccn12)C(=O)CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H25N5O3/c1-17(2,3)25-16(24)18-10-7-9-15(23)21(4)12-14-20-19-13-8-5-6-11-22(13)14/h5-6,8,11H,7,9-10,12H2,1-4H3,(H,18,24) |
| InChIKey | ZOFOOHPKKHZQNV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|