C20H32N2O5 — CID 9277255
tert-butyl N-[4-[(4,5-dimethoxy-2-methylphenyl)methyl-methylamino]-4-oxobutyl]carbamate (PubChem CID 9277255) has the molecular formula C20H32N2O5 and a molecular weight of 380.49 g/mol. Its IUPAC name is tert-butyl N-[4-[(4,5-dimethoxy-2-methylphenyl)methyl-methylamino]-4-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[4-[(4,5-dimethoxy-2-methylphenyl)methyl-methylamino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 9277255 |
| Molecular Formula | C20H32N2O5 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | tert-butyl N-[4-[(4,5-dimethoxy-2-methylphenyl)methyl-methylamino]-4-oxobutyl]carbamate |
| SMILES | COc1cc(C)c(CN(C)C(=O)CCCNC(=O)OC(C)(C)C)cc1OC |
| InChI | InChI=1S/C20H32N2O5/c1-14-11-16(25-6)17(26-7)12-15(14)13-22(5)18(23)9-8-10-21-19(24)27-20(2,3)4/h11-12H,8-10,13H2,1-7H3,(H,21,24) |
| InChIKey | XOLGLXWARAJLHG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|