C18H27ClN2O3 — CID 33164457
N-[4-[(5-chloro-2-methoxyphenyl)methyl-methylamino]-4-oxobutyl]-2,2-dimethylpropanamide (PubChem CID 33164457) has the molecular formula C18H27ClN2O3 and a molecular weight of 354.88 g/mol. Its IUPAC name is N-[4-[(5-chloro-2-methoxyphenyl)methyl-methylamino]-4-oxobutyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-[(5-chloro-2-methoxyphenyl)methyl-methylamino]-4-oxobutyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 33164457 |
| Molecular Formula | C18H27ClN2O3 |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-[4-[(5-chloro-2-methoxyphenyl)methyl-methylamino]-4-oxobutyl]-2,2-dimethylpropanamide |
| SMILES | COc1ccc(Cl)cc1CN(C)C(=O)CCCNC(=O)C(C)(C)C |
| InChI | InChI=1S/C18H27ClN2O3/c1-18(2,3)17(23)20-10-6-7-16(22)21(4)12-13-11-14(19)8-9-15(13)24-5/h8-9,11H,6-7,10,12H2,1-5H3,(H,20,23) |
| InChIKey | KQMOLCJPBRPYSE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|